1-(4-nitrophenyl)sulfanyl-4-propan-2-ylbenzene structure
|
Common Name | 1-(4-nitrophenyl)sulfanyl-4-propan-2-ylbenzene | ||
|---|---|---|---|---|
| CAS Number | 200123-22-4 | Molecular Weight | 273.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-nitrophenyl)sulfanyl-4-propan-2-ylbenzene |
|---|
| Molecular Formula | C15H15NO2S |
|---|---|
| Molecular Weight | 273.35000 |
| Exact Mass | 273.08200 |
| PSA | 71.12000 |
| LogP | 5.39260 |
| InChIKey | SUXAMKBRCBZPNB-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(Sc2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
1-(4-nitropheny... CAS#:200123-22-4 |
| Literature: Gilman; Broadbent Journal of the American Chemical Society, 1947 , vol. 69, p. 2053,2055 |
|
~%
1-(4-nitropheny... CAS#:200123-22-4 |
| Literature: Clark, Robin D.; Jahangir, Alam; Severance, Daniel; Salazar, Rick; Chang, Thomas; Chang, David; Jett, Mary Frances; Smith, Steven; Bley, Keith Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 4 p. 1053 - 1056 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |