1,5,8-Trimethyl-6,7-dihydronaphtho[2,1-b]furan
![1,5,8-Trimethyl-6,7-dihydronaphtho[2,1-b]furan Structure](https://image.chemsrc.com/caspic/436/20013-75-6.png)
1,5,8-Trimethyl-6,7-dihydronaphtho[2,1-b]furan structure
|
Common Name | 1,5,8-Trimethyl-6,7-dihydronaphtho[2,1-b]furan | ||
|---|---|---|---|---|
| CAS Number | 20013-75-6 | Molecular Weight | 212.287 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 327.3±11.0 °C at 760 mmHg | |
| Molecular Formula | C15H16O | Melting Point | 76.5-77.5℃ | |
| MSDS | N/A | Flash Point | 155.0±6.1 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Pyrocurzerenone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 327.3±11.0 °C at 760 mmHg |
| Melting Point | 76.5-77.5℃ |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.287 |
| Flash Point | 155.0±6.1 °C |
| Exact Mass | 212.120117 |
| PSA | 13.14000 |
| LogP | 5.39 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | JSWOSPDHAFLJHZ-UHFFFAOYSA-N |
| SMILES | CC1=Cc2c(c(C)cc3occ(C)c23)CC1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2932999099 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,5,8-Trimethyl-6,7-dihydronaphtho[2,1-b]furan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of Pyrocurzerenone? |
| A: Boiling point of Pyrocurzerenone is 327.3±11.0 °C at 760 mmHg. |
| Q: What is the InChIKey of Pyrocurzerenone? |
| A: InChIKey of Pyrocurzerenone is JSWOSPDHAFLJHZ-UHFFFAOYSA-N. |
| Q: What is the LogP of Pyrocurzerenone? |
| A: LogP of Pyrocurzerenone is 5.39. |
| Q: What is the English name of Pyrocurzerenone? |
| A: The English name of Pyrocurzerenone is Pyrocurzerenone. |
| Q: What is the CAS number of Pyrocurzerenone? |
| A: CAS number of Pyrocurzerenone is 20013-75-6. |
| Q: What English synonyms does Pyrocurzerenone have? |
| A: English synonyms of Pyrocurzerenone: 1,5,8-Trimethyl-6,7-dihydronaphtho[2,1-b]furan. |
| Q: What is the molecular weight of Pyrocurzerenone? |
| A: Molecular weight of Pyrocurzerenone is 212.287. |
| Q: What is the molecular formula of Pyrocurzerenone? |
| A: Molecular formula of Pyrocurzerenone is C15H16O. |
| Q: What is the SMILES notation of Pyrocurzerenone? |
| A: SMILES notation of Pyrocurzerenone is CC1=Cc2c(c(C)cc3occ(C)c23)CC1. |
| Q: What is the melting point of Pyrocurzerenone? |
| A: Melting point of Pyrocurzerenone is 76.5-77.5℃. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |
| Dayang Chem (Hangzhou) Co., Ltd. |