1,5,8-Trimethyl-6,7-dihydronaphtho[2,1-b]furan structure
|
Common Name | 1,5,8-Trimethyl-6,7-dihydronaphtho[2,1-b]furan | ||
|---|---|---|---|---|
| CAS Number | 20013-75-6 | Molecular Weight | 212.287 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 327.3±11.0 °C at 760 mmHg | |
| Molecular Formula | C15H16O | Melting Point | 76.5-77.5℃ | |
| MSDS | N/A | Flash Point | 155.0±6.1 °C | |
| Name | Pyrocurzerenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 327.3±11.0 °C at 760 mmHg |
| Melting Point | 76.5-77.5℃ |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.287 |
| Flash Point | 155.0±6.1 °C |
| Exact Mass | 212.120117 |
| PSA | 13.14000 |
| LogP | 5.39 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | JSWOSPDHAFLJHZ-UHFFFAOYSA-N |
| SMILES | CC1=Cc2c(c(C)cc3occ(C)c23)CC1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,5,8-Trimethyl-6,7-dihydronaphtho[2,1-b]furan |