1-(2,4-Dimethylanilino)-3-(isopropylamino)-2-propanol structure
|
Common Name | 1-(2,4-Dimethylanilino)-3-(isopropylamino)-2-propanol | ||
|---|---|---|---|---|
| CAS Number | 20013-91-6 | Molecular Weight | 236.35300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,4-dimethylanilino)-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H24N2O |
|---|---|
| Molecular Weight | 236.35300 |
| Exact Mass | 236.18900 |
| PSA | 44.29000 |
| LogP | 2.53810 |
| InChIKey | PPUIITGCHQYTHL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NCC(O)CNC(C)C)c(C)c1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-[(2,4-dimethylphenyl)amino]-3-(propan-2-ylamino)propan-2-ol |
| 1-(2,4-Dimethylanilino)-3-(isopropylamino)-2-propanol |