Sulfone, p-chlorophenyl diiodomethyl structure
|
Common Name | Sulfone, p-chlorophenyl diiodomethyl | ||
|---|---|---|---|---|
| CAS Number | 20018-12-6 | Molecular Weight | 442.44000 | |
| Density | 2.441g/cm3 | Boiling Point | 435.7ºC at 760 mmHg | |
| Molecular Formula | C7H5ClI2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.3ºC | |
| Name | 1-chloro-4-(diiodomethylsulfonyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.441g/cm3 |
|---|---|
| Boiling Point | 435.7ºC at 760 mmHg |
| Molecular Formula | C7H5ClI2O2S |
| Molecular Weight | 442.44000 |
| Flash Point | 217.3ºC |
| Exact Mass | 441.77900 |
| PSA | 42.52000 |
| LogP | 4.34810 |
| Vapour Pressure | 2.18E-07mmHg at 25°C |
| Index of Refraction | 1.71 |
| InChIKey | GASOXIRLBJILKE-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)C(I)I |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Amical 79 |
| Amical 77 |
| Sulfone,p-chlorophenyl diiodomethyl |
| 4-Chlorophenyl diiodomethyl sulfone |
| p-Chlorophenyl diiodomethyl sulfone |
| 4-Chlorphenyl-dijodmethyl-sulfon |
| Diiodomethyl p-chlorophenyl sulfone |
| p-Chlorphenyl-diiodmethylsulfon |