Pro-Leu-Gly-NH2 structure
|
Common Name | Pro-Leu-Gly-NH2 | ||
|---|---|---|---|---|
| CAS Number | 2002-44-0 | Molecular Weight | 284.35500 | |
| Density | 1.147g/cm3 | Boiling Point | 626.2ºC at 760mmHg | |
| Molecular Formula | C13H24N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332.5ºC | |
Use of Pro-Leu-Gly-NH2MIF-1 (Melanostatin), an endogenous brain peptide, is a potent dopamine receptor allosteric modulator. MIF-1 inhibits melanin formation. MIF-1 blocks the effects of opioid receptor activation to modulate the analgesic effects of morphine and stress-induced analgesia (SIA). MIF-1 accesses from the blood to the CNS by directly crossing the blood-brain barrier (BBB)[1][2][3]. |
| Name | (2S)-N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | MIF-1 (Melanostatin), an endogenous brain peptide, is a potent dopamine receptor allosteric modulator. MIF-1 inhibits melanin formation. MIF-1 blocks the effects of opioid receptor activation to modulate the analgesic effects of morphine and stress-induced analgesia (SIA). MIF-1 accesses from the blood to the CNS by directly crossing the blood-brain barrier (BBB)[1][2][3]. |
|---|---|
| Related Catalog | |
| In Vitro | MIF-1 (Melanostatin, 1 μM) provokes a reversible hyperpolarization and a suppression of spontaneous action potentials[2]. |
| In Vivo | MIF-1 (Melanostatin, 1 mg/kg; i.p.; once, for 1 hour; male Wistar rats) modulates the analgesic effects of morphine and stress-induced analgesia (SIA)[1]. MIF-1 (Melanostatin, 1 mg/kg; i.p.; daily, for 8 weeks; Sprague-Dawley rats) attenuates spiroperidol-induced impairment of development of striatal dopamine D2 receptors in rats[3]. Animal Model: Male Wistar rats[1] Dosage: 1 mg/kg Administration: Intraperitoneal injection; once, for 1 hour Result: Decreased the analgesic effect of morphine. Increased the pain threshold for at least 1 h. Animal Model: Sprague-Dawley rats[3] Dosage: 1 mg/kg Administration: Intraperitoneal injection; daily, for 8 weeks Result: Attenuated the ontogenic impairment of striatal D2 receptors that was produced by spiroperidol (HY-B1371) treatment. |
| References |
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 626.2ºC at 760mmHg |
| Molecular Formula | C13H24N4O3 |
| Molecular Weight | 284.35500 |
| Flash Point | 332.5ºC |
| Exact Mass | 284.18500 |
| PSA | 113.32000 |
| LogP | 0.68170 |
| Vapour Pressure | 1.34E-15mmHg at 25°C |
| Index of Refraction | 1.51 |
| InChIKey | NOOJLZTTWSNHOX-UWVGGRQHSA-N |
| SMILES | CC(C)CC(NC(=O)C1CCCN1)C(=O)NCC(N)=O |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| Oxytocin C-terminal tripeptide |
| Melanocyte stimulating hormone release inhibiting factor |
| MSH-release inhibiting factor I |
| MIF-I Melanostatin Oxytocin fragment 7-9 |
| L-Prolyl-L-leucylglycinamide |
| MFCD00037866 |
| MELANOSTATIN |
| EINECS 217-902-7 |
| Pro-Leu-Gly-NH2 |
| L-Prolyl-L-leucylglycylamide |
| melanocyte-stimulating hormone release-inhibiting factor-1 |
| MIF-I |
| Prolylleucylglycine amide |
| 7-9-Oxytocin |
| MIF-1 |