(2,6-DIMETHOXY-PHENOXY)-ACETICACIDETHYLESTER structure
|
Common Name | (2,6-DIMETHOXY-PHENOXY)-ACETICACIDETHYLESTER | ||
|---|---|---|---|---|
| CAS Number | 2002-68-8 | Molecular Weight | 266.13400 | |
| Density | 1.736g/cm3 | Boiling Point | 301.8ºC at 760mmHg | |
| Molecular Formula | C7H5F3N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.3ºC | |
| Name | [2,6-dinitro-4-(trifluoromethyl)phenyl]hydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.736g/cm3 |
|---|---|
| Boiling Point | 301.8ºC at 760mmHg |
| Molecular Formula | C7H5F3N4O4 |
| Molecular Weight | 266.13400 |
| Flash Point | 136.3ºC |
| Exact Mass | 266.02600 |
| PSA | 129.69000 |
| LogP | 3.62710 |
| Vapour Pressure | 0.00103mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | ONKIRGVIGHJYHR-UHFFFAOYSA-N |
| SMILES | NNc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| HS Code | 2928000090 |
|---|
|
~%
(2,6-DIMETHOXY-... CAS#:2002-68-8 |
| Literature: Reese, Colin B.; Pei-Zhuo, Zhang Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1993 , # 19 p. 2291 - 2302 |
|
~%
(2,6-DIMETHOXY-... CAS#:2002-68-8 |
| Literature: Reese, Colin B.; Pei-Zhuo, Zhang Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1993 , # 19 p. 2291 - 2302 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,6-dinitro-4-(trifluoromethyl)phenylhydrazine |
| (2,6-Dinitro-4-trifluormethyl-phenyl)-hydrazin |