1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene
1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene structure
|
Common Name | 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 2002-99-5 | Molecular Weight | 262.12400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5F7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H5F7O |
|---|---|
| Molecular Weight | 262.12400 |
| Exact Mass | 262.02300 |
| PSA | 9.23000 |
| LogP | 3.66050 |
| InChIKey | XNCNFARMNBSGEU-UHFFFAOYSA-N |
| SMILES | CCOc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2909309090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-Ethoxy-2,3,5,... CAS#:2002-99-5 |
| Literature: Kobrina,L.S. et al. Journal of Organic Chemistry USSR (English Translation), 1970 , vol. 6, p. 510 - 517 Zhurnal Organicheskoi Khimii, 1970 , vol. 6, # 3 p. 512 - 520 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-n-Butyl-4-ethoxypyridin-2-carbonsaeure |
| 4-Ethoxyfusarsaeure |
| 4-Ethoxyheptafluortoluol |
| 5-butyl-4-ethoxy-pyridine-2-carboxylic acid |
| 2-Pyridinecarboxylic acid,5-butyl-4-ethoxy |
| 1,2,4,5-Tetrafluor-3-ethoxy-6-trifluormethylbenzol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene? |
| A: LogP of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene is 3.66050. |
| Q: What is the molecular weight of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene? |
| A: Molecular weight of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene is 262.12400. |
| Q: What is the English name of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene? |
| A: The English name of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene is 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene. |
| Q: What English synonyms does 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene have? |
| A: English synonyms of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene: 5-n-Butyl-4-ethoxypyridin-2-carbonsaeure, 4-Ethoxyfusarsaeure, 4-Ethoxyheptafluortoluol, 5-butyl-4-ethoxy-pyridine-2-carboxylic acid, 2-Pyridinecarboxylic acid,5-butyl-4-ethoxy, 1,2,4,5-Tetrafluor-3-ethoxy-6-trifluormethylbenzol. |
| Q: What is the Chinese name of 2002-99-5? |
| A: Chinese name of 2002-99-5 is 2002-99-5. |
| Q: What is the CAS number of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene? |
| A: CAS number of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene is 2002-99-5. |
| Q: What is the InChIKey of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene? |
| A: InChIKey of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene is XNCNFARMNBSGEU-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene? |
| A: Polar surface area (PSA) of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene is 9.23000. |
| Q: What is the molecular formula of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene? |
| A: Molecular formula of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene is C9H5F7O. |
| Q: What is the SMILES notation of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene? |
| A: SMILES notation of 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene is CCOc1c(F)c(F)c(C(F)(F)F)c(F)c1F. |