1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene structure
|
Common Name | 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 2002-99-5 | Molecular Weight | 262.12400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5F7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Ethoxy-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H5F7O |
|---|---|
| Molecular Weight | 262.12400 |
| Exact Mass | 262.02300 |
| PSA | 9.23000 |
| LogP | 3.66050 |
| InChIKey | XNCNFARMNBSGEU-UHFFFAOYSA-N |
| SMILES | CCOc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| HS Code | 2909309090 |
|---|
|
~%
1-Ethoxy-2,3,5,... CAS#:2002-99-5 |
| Literature: Kobrina,L.S. et al. Journal of Organic Chemistry USSR (English Translation), 1970 , vol. 6, p. 510 - 517 Zhurnal Organicheskoi Khimii, 1970 , vol. 6, # 3 p. 512 - 520 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5-n-Butyl-4-ethoxypyridin-2-carbonsaeure |
| 4-Ethoxyfusarsaeure |
| 4-Ethoxyheptafluortoluol |
| 5-butyl-4-ethoxy-pyridine-2-carboxylic acid |
| 2-Pyridinecarboxylic acid,5-butyl-4-ethoxy |
| 1,2,4,5-Tetrafluor-3-ethoxy-6-trifluormethylbenzol |