2-Cyclopropyl-1,3-thiazole-5-sulfonamide
Modify Date: 2026-09-27 17:50:16
2-Cyclopropyl-1,3-thiazole-5-sulfonamide structure
|
Common Name | 2-Cyclopropyl-1,3-thiazole-5-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 2002173-18-2 | Molecular Weight | 204.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H8N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Cyclopropyl-1,3-thiazole-5-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H8N2O2S2 |
|---|---|
| Molecular Weight | 204.3 |
| InChIKey | CUTUJIXRCUHALE-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cnc(C2CC2)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Cyclopropyl-1,3-thiazole-5-sulfonamide? |
| A: CAS number of 2-Cyclopropyl-1,3-thiazole-5-sulfonamide is 2002173-18-2. |
| Q: What is the Chinese name of 2002173-18-2? |
| A: Chinese name of 2002173-18-2 is 2002173-18-2. |
| Q: What is the molecular weight of 2-Cyclopropyl-1,3-thiazole-5-sulfonamide? |
| A: Molecular weight of 2-Cyclopropyl-1,3-thiazole-5-sulfonamide is 204.3. |
| Q: What is the molecular formula of 2-Cyclopropyl-1,3-thiazole-5-sulfonamide? |
| A: Molecular formula of 2-Cyclopropyl-1,3-thiazole-5-sulfonamide is C6H8N2O2S2. |
| Q: What is the English name of 2-Cyclopropyl-1,3-thiazole-5-sulfonamide? |
| A: The English name of 2-Cyclopropyl-1,3-thiazole-5-sulfonamide is 2-Cyclopropyl-1,3-thiazole-5-sulfonamide. |
| Q: What is the InChIKey of 2-Cyclopropyl-1,3-thiazole-5-sulfonamide? |
| A: InChIKey of 2-Cyclopropyl-1,3-thiazole-5-sulfonamide is CUTUJIXRCUHALE-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-Cyclopropyl-1,3-thiazole-5-sulfonamide? |
| A: SMILES notation of 2-Cyclopropyl-1,3-thiazole-5-sulfonamide is NS(=O)(=O)c1cnc(C2CC2)s1. |