4-benzhydryl-6-bromo-2-methyl-1,2,4-triazine-3,5-dione structure
|
Common Name | 4-benzhydryl-6-bromo-2-methyl-1,2,4-triazine-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 20028-49-3 | Molecular Weight | 372.21600 | |
| Density | 1.46g/cm3 | Boiling Point | 465ºC at 760 mmHg | |
| Molecular Formula | C17H14BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235ºC | |
| Name | 4-benzhydryl-6-bromo-2-methyl-1,2,4-triazine-3,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 465ºC at 760 mmHg |
| Molecular Formula | C17H14BrN3O2 |
| Molecular Weight | 372.21600 |
| Flash Point | 235ºC |
| Exact Mass | 371.02700 |
| PSA | 56.89000 |
| LogP | 2.34220 |
| Vapour Pressure | 7.98E-09mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | BMUAAGJRSZOPBV-UHFFFAOYSA-N |
| SMILES | Cn1nc(Br)c(=O)n(C(c2ccccc2)c2ccccc2)c1=O |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 4-benzhydryl-6-bromo-2-methyl-2H-[1,2,4]triazine-3,5-dione |
| 1-Methyl-3-diphenylmethyl-5-brom-6-azauracil |
| 4-Benzhydryl-6-bromo-2-methyl-1,2,4-triazine-3,5(2H,4H)-dione |