Formamide,N-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]- structure
|
Common Name | Formamide,N-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]- | ||
|---|---|---|---|---|
| CAS Number | 20028-84-6 | Molecular Weight | 210.23600 | |
| Density | 1.298g/cm3 | Boiling Point | 378.7ºC at 760 mmHg | |
| Molecular Formula | C8H14N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.8ºC | |
| Name | N-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]formamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 378.7ºC at 760 mmHg |
| Molecular Formula | C8H14N6O |
| Molecular Weight | 210.23600 |
| Flash Point | 182.8ºC |
| Exact Mass | 210.12300 |
| PSA | 74.25000 |
| LogP | 0.28080 |
| Vapour Pressure | 6.17E-06mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | IQEGCJQWACFEFX-UHFFFAOYSA-N |
| SMILES | CN(C)c1nc(NC=O)nc(N(C)C)n1 |
|
~55%
Formamide,N-[4,... CAS#:20028-84-6 |
| Literature: Hashida, Yoji; Imai, Akira; Sekiguchi, Shizen Journal of Heterocyclic Chemistry, 1989 , vol. 26, p. 901 - 905 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4-Bis(dimethylamino)-6-formylamino-1,3,5-triazine |
| N-<4,6-Bis-(dimethylamino)-1,3,5-triazinyl-(2)>-formamid |
| N-(4,6-bis-dimethylamino-[1,3,5]triazin-2-yl)-formamide |