1,1-bis(2-chloroethyl)-3-(4-nitrophenyl)urea structure
|
Common Name | 1,1-bis(2-chloroethyl)-3-(4-nitrophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 2003-46-5 | Molecular Weight | 306.14500 | |
| Density | 1.431g/cm3 | Boiling Point | 517.6ºC at 760 mmHg | |
| Molecular Formula | C11H13Cl2N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.9ºC | |
| Name | 2,2'-diamino-3H,3'H-6,6'-propane-1,3-diylidenediamino-bis-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.431g/cm3 |
|---|---|
| Boiling Point | 517.6ºC at 760 mmHg |
| Molecular Formula | C11H13Cl2N3O3 |
| Molecular Weight | 306.14500 |
| Flash Point | 266.9ºC |
| Exact Mass | 305.03300 |
| PSA | 78.16000 |
| LogP | 3.50250 |
| Vapour Pressure | 8.06E-11mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | MPPPCUOMBLPUJK-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)N(CCCl)CCCl |
|
~%
1,1-bis(2-chlor... CAS#:2003-46-5 |
| Literature: Popp,F.D.; Swarz,H. Journal of Organic Chemistry, 1961 , vol. 26, p. 4764 - 4765 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-<4-Nitro-phenyl>-N'-bis-<2-chlor-aethyl>-harnstoff |
| N-<4-Nitro-phenyl>-N'.N'-bis-<2-chlor-aethyl>-harnstoff |