2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione
Modify Date: 2025-10-15 21:38:06
![2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione Structure](https://www.chemsrc.com/extcaspic/393/2003113-71-9.png)
2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione structure
|
Common Name | 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione | ||
|---|---|---|---|---|
| CAS Number | 2003113-71-9 | Molecular Weight | 230.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H14N4O2S |
|---|---|
| Molecular Weight | 230.29 |
| InChIKey | KPKIQWRZLVPCJU-UHFFFAOYSA-N |
| SMILES | Nc1ncn(CC2CCCCS2(=O)=O)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione? |
| A: Molecular formula of 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione is C8H14N4O2S. |
| Q: What is the molecular weight of 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione? |
| A: Molecular weight of 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione is 230.29. |
| Q: What is the SMILES notation of 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione? |
| A: SMILES notation of 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione is Nc1ncn(CC2CCCCS2(=O)=O)n1. |
| Q: What is the InChIKey of 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione? |
| A: InChIKey of 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione is KPKIQWRZLVPCJU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione? |
| A: CAS number of 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione is 2003113-71-9. |
| Q: What is the English name of 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione? |
| A: The English name of 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione is 2-[(3-amino-1H-1,2,4-triazol-1-yl)methyl]-1lambda6-thiane-1,1-dione. |
| Q: What is the Chinese name of 2003113-71-9? |
| A: Chinese name of 2003113-71-9 is 2003113-71-9. |