alpha-(4-Methoxybenzoyl)-2-chloro-4-nitroacetanilide structure
|
Common Name | alpha-(4-Methoxybenzoyl)-2-chloro-4-nitroacetanilide | ||
|---|---|---|---|---|
| CAS Number | 20043-88-3 | Molecular Weight | 348.73800 | |
| Density | 1.416 g/cm3 | Boiling Point | 603.2ºC at 760 mmHg | |
| Molecular Formula | C16H13ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-3-(4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)-3-oxo-N-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.416 g/cm3 |
|---|---|
| Boiling Point | 603.2ºC at 760 mmHg |
| Molecular Formula | C16H13ClN2O5 |
| Molecular Weight | 348.73800 |
| Exact Mass | 348.05100 |
| PSA | 101.22000 |
| LogP | 4.06450 |
| Index of Refraction | 1.635 |
| InChIKey | BNHPCIZXJFGDSL-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CC(=O)Nc2ccc([N+](=O)[O-])cc2Cl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| i06-1462 |