Boron sodium oxide (B5NaO8), labeled with boron-10 structure
|
Common Name | Boron sodium oxide (B5NaO8), labeled with boron-10 | ||
|---|---|---|---|---|
| CAS Number | 200443-98-7 | Molecular Weight | 201.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | B5NaO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Boron sodium oxide (B5NaO8), labeled with boron-10 |
|---|
| Molecular Formula | B5NaO8 |
|---|---|
| Molecular Weight | 201.05 |
| InChIKey | OFWHLDSMUYNYEZ-WYQORLDKSA-N |
| SMILES | [Na+].[O-]B1OB2OB(O1)OB1OB(O2)O1 |