1-anilino-3-(3-methylphenyl)urea structure
|
Common Name | 1-anilino-3-(3-methylphenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 20049-85-8 | Molecular Weight | 241.28800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-anilino-3-(3-methylphenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H15N3O |
|---|---|
| Molecular Weight | 241.28800 |
| Exact Mass | 241.12200 |
| PSA | 56.65000 |
| LogP | 3.62110 |
| InChIKey | BJNJONGHABJTLZ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(NC(=O)NNc2ccccc2)c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-Me-Ph-NHCONHNH-Ph |