5-(Chlorosulfonyl)-2-ethoxybenzoic acid structure
|
Common Name | 5-(Chlorosulfonyl)-2-ethoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 200575-16-2 | Molecular Weight | 264.68300 | |
| Density | 1.477 g/cm3 | Boiling Point | 446.5ºC at 760 mmHg | |
| Molecular Formula | C9H9ClO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.8ºC | |
| Name | 5-chlorosulfonyl-2-ethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.477 g/cm3 |
|---|---|
| Boiling Point | 446.5ºC at 760 mmHg |
| Molecular Formula | C9H9ClO5S |
| Molecular Weight | 264.68300 |
| Flash Point | 223.8ºC |
| Exact Mass | 263.98600 |
| PSA | 89.05000 |
| LogP | 2.79180 |
| InChIKey | UHNRCKXZRULNSC-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(S(=O)(=O)Cl)cc1C(=O)O |
| HS Code | 2918990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-chlorosulphonyl-2-ethoxy benzoic acid |
| 2-ethoxy-5-chlorosulphonyl-benzoic acid |
| 2-ethoxy-5-chlorosulfonylbenzoic acid |
| 5-Chlorosulfonyl-2-ethoxybenzoicacid |