4H-Azepin-4-one,hexahydro-1-methyl-, compd. with 2,4,6-trinitrophenol (1:1) structure
|
Common Name | 4H-Azepin-4-one,hexahydro-1-methyl-, compd. with 2,4,6-trinitrophenol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 2006-44-2 | Molecular Weight | 356.28800 | |
| Density | N/A | Boiling Point | 303.6ºC at 760mmHg | |
| Molecular Formula | C13H16N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.9ºC | |
| Name | 1-methylazepan-4-one,2,4,6-trinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 303.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C13H16N4O8 |
| Molecular Weight | 356.28800 |
| Flash Point | 133.9ºC |
| Exact Mass | 356.09700 |
| PSA | 178.00000 |
| LogP | 3.29550 |
| Vapour Pressure | 0.000514mmHg at 25°C |
| InChIKey | HPUBEXTWMHBKBB-UHFFFAOYSA-N |
| SMILES | CN1CCCC(=O)CC1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| 1-methyl-hexahydro-azepin-4-one,picrate |
| 1-Methyl-hexahydro-azepin-4-on,Picrat |