N-[3-(dimethylamino)propyl]-1-nitroacridin-9-amine oxide structure
|
Common Name | N-[3-(dimethylamino)propyl]-1-nitroacridin-9-amine oxide | ||
|---|---|---|---|---|
| CAS Number | 20063-73-4 | Molecular Weight | 339.36800 | |
| Density | N/A | Boiling Point | 575.4ºC at 760 mmHg | |
| Molecular Formula | C18H19N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.8ºC | |
| Name | N-[3-(dimethylamino)propyl]-1-nitroacridin-9-amine oxide |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 575.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H19N4O3 |
| Molecular Weight | 339.36800 |
| Flash Point | 301.8ºC |
| Exact Mass | 339.14600 |
| PSA | 91.38000 |
| LogP | 4.70470 |
| Vapour Pressure | 4.43E-14mmHg at 25°C |
| InChIKey | SFLRYQNKXUDXBN-UHFFFAOYSA-N |
| SMILES | CN(C)CCC[NH+]([O-])c1c2ccccc2nc2cccc([N+](=O)[O-])c12 |
| HS Code | 2933990090 |
|---|
|
~99%
N-[3-(dimethyla... CAS#:20063-73-4 |
| Literature: Lee; Wilson; Ferry; Van Zijl; Pullen; Denny Journal of Medicinal Chemistry, 1996 , vol. 39, # 13 p. 2508 - 2517 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| C 684 |
| Nitracrine N-oxide |