1-[5-(2-triethoxysilylethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethanone structure
|
Common Name | 1-[5-(2-triethoxysilylethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 200631-17-0 | Molecular Weight | 368.49700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H28O6Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[5-(2-triethoxysilylethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethanone |
|---|
| Molecular Formula | C18H28O6Si |
|---|---|
| Molecular Weight | 368.49700 |
| Exact Mass | 368.16600 |
| PSA | 63.22000 |
| LogP | 3.25130 |
| InChIKey | NHPZIPOGHJPCIH-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCc1c(C(C)=O)ccc2c1OCCO2)(OCC)OCC |
|
~98%
1-[5-(2-trietho... CAS#:200631-17-0 |
| Literature: Martinez, Remi; Simon, Marc-Olivier; Chevalier, Reynald; Pautigny, Cyrielle; Genet, Jean-Pierre; Darses, Sylvain Journal of the American Chemical Society, 2009 , vol. 131, p. 7887 - 7895 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |