4-((4-(Aminomethyl)pyridin-2-yl)oxy)-N-phenylbenzamide hydrochloride structure
|
Common Name | 4-((4-(Aminomethyl)pyridin-2-yl)oxy)-N-phenylbenzamide hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2006331-17-3 | Molecular Weight | 355.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-((4-(Aminomethyl)pyridin-2-yl)oxy)-N-phenylbenzamide hydrochloride |
|---|
| Molecular Formula | C19H18ClN3O2 |
|---|---|
| Molecular Weight | 355.8 |
| InChIKey | FPKWXZXFSKOCNZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=C(C=C2)OC3=NC=CC(=C3)CN.Cl |
|
Name: Inhibition of human LOX expressed in HEK cells assessed as reduction of H2O2 producti...
Source: ChEMBL
Target: Protein-lysine 6-oxidase
External Id: CHEMBL4052333
|
|
Name: Inhibition of recombinant human LOXL2 expressed in human whole blood assessed as redu...
Source: ChEMBL
Target: Lysyl oxidase homolog 2
External Id: CHEMBL4052334
|
|
Name: Inhibition of human LOXL2 expressed in CHO cells assessed as reduction of H2O2 produc...
Source: ChEMBL
Target: Lysyl oxidase homolog 2
External Id: CHEMBL4052332
|
|
Name: Inhibition of human LOXL2 expressed in CHO cells assessed as reduction of H2O2 produc...
Source: ChEMBL
Target: Lysyl oxidase homolog 2
External Id: CHEMBL4052329
|