Carbamic acid, heptyl-, I+/--ester with 2,2-dichloro-N-[I(2)-hydroxy-I+/--(hydroxymethyl)-p-nitrophenethyl]acetamide, D-threo-(-)- structure
|
Common Name | Carbamic acid, heptyl-, I+/--ester with 2,2-dichloro-N-[I(2)-hydroxy-I+/--(hydroxymethyl)-p-nitrophenethyl]acetamide, D-threo-(-)- | ||
|---|---|---|---|---|
| CAS Number | 20066-10-8 | Molecular Weight | 464.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H27Cl2N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Carbamic acid, heptyl-, I+/--ester with 2,2-dichloro-N-[I(2)-hydroxy-I+/--(hydroxymethyl)-p-nitrophenethyl]acetamide, D-threo-(-)- |
|---|
| Molecular Formula | C19H27Cl2N3O6 |
|---|---|
| Molecular Weight | 464.3 |
| InChIKey | KTZFVEUMLCIVGO-HZPDHXFCSA-N |
| SMILES | CCCCCCCNC(=O)OCC(NC(=O)C(Cl)Cl)C(O)c1ccc([N+](=O)[O-])cc1 |