3-hydroxy-4-nitroso-2,7-Naphthalenedisulfonic acid
Modify Date: 2025-09-24 17:13:23
3-hydroxy-4-nitroso-2,7-Naphthalenedisulfonic acid structure
|
Common Name | 3-hydroxy-4-nitroso-2,7-Naphthalenedisulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 2007-19-4 | Molecular Weight | 333.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7NO8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxy-4-nitroso-2,7-Naphthalenedisulfonic acid |
|---|
| Molecular Formula | C10H7NO8S2 |
|---|---|
| Molecular Weight | 333.29400 |
| Exact Mass | 332.96100 |
| PSA | 175.16000 |
| LogP | 3.59830 |
| InChIKey | MVQXMYZZBIYPMW-UHFFFAOYSA-N |
| SMILES | O=Nc1c(O)c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)ccc12 |
| HS Code | 2908999090 |
|---|
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
Total 1, Current Page 1 of 1
1