1-(Isopropylamino)-3-(naphthalen-2-yloxy)propan-2-ol structure
|
Common Name | 1-(Isopropylamino)-3-(naphthalen-2-yloxy)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 2007-72-9 | Molecular Weight | 259.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(Isopropylamino)-3-(naphthalen-2-yloxy)propan-2-ol |
|---|
| Molecular Formula | C16H21NO2 |
|---|---|
| Molecular Weight | 259.34 |
| InChIKey | PIANUSMCKHEMFQ-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(O)COc1ccc2ccccc2c1 |
|
Name: Beta-1 adrenergic receptor activation measured by isoprenaline-induced positive inotr...
Source: ChEMBL
Target: Beta-1 adrenergic receptor
External Id: CHEMBL653377
|
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Selectivity of inhibition at beta-1 versus beta-2 adrenergic receptors, ratio of pA2 ...
Source: ChEMBL
Target: N/A
External Id: CHEMBL846692
|
|
Name: Antagonism of isoprenaline-induced relaxation of guinea pig tracheal chains, contract...
Source: ChEMBL
Target: Beta-2 adrenergic receptor
External Id: CHEMBL687608
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|