7-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole structure
|
Common Name | 7-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 200714-22-3 | Molecular Weight | 216.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13FN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13FN2 |
|---|---|
| Molecular Weight | 216.25400 |
| Exact Mass | 216.10600 |
| PSA | 27.82000 |
| LogP | 3.01250 |
| InChIKey | LGCVGUGCTQBGJA-UHFFFAOYSA-N |
| SMILES | Fc1cccc2c(C3=CCNCC3)c[nH]c12 |
| HS Code | 2933990090 |
|---|
|
~%
7-fluoro-3-(1,2... CAS#:200714-22-3 |
| Literature: ELI LILLY AND COMPANY Patent: EP812826 A1, 1997 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| W4242 |
| 6-tetrahydro-pyridin-4-yl)-1H-indole |