Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate
Modify Date: 2026-08-31 19:08:24
Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate structure
|
Common Name | Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate | ||
|---|---|---|---|---|
| CAS Number | 2007159-30-8 | Molecular Weight | 446.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H42N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H42N2O5S |
|---|---|
| Molecular Weight | 446.6 |
| InChIKey | MWDURGIAMJOSBG-LYZYBISQSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CSCC(NC(=O)OC(C)(C)C)C(O)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate? |
| A: The English name of Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate is Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate. |
| Q: What is the molecular formula of Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate? |
| A: Molecular formula of Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate is C22H42N2O5S. |
| Q: What is the SMILES notation of Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate? |
| A: SMILES notation of Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate is C1CCC(NC2CCCCC2)CC1.CSCC(NC(=O)OC(C)(C)C)C(O)C(=O)O. |
| Q: What is the Chinese name of 2007159-30-8? |
| A: Chinese name of 2007159-30-8 is 2007159-30-8. |
| Q: What is the molecular weight of Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate? |
| A: Molecular weight of Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate is 446.6. |
| Q: What is the InChIKey of Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate? |
| A: InChIKey of Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate is MWDURGIAMJOSBG-LYZYBISQSA-N. |
| Q: What is the CAS number of Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate? |
| A: CAS number of Dicyclohexylamine (2S,3S)-3-((tert-butoxycarbonyl)amino)-2-hydroxy-4-(methylthio)butanoate is 2007159-30-8. |