3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline
Modify Date: 2026-08-19 20:50:42
![3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline Structure](https://www.chemsrc.com/extcaspic/076/2007738-61-4.png)
3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline structure
|
Common Name | 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 2007738-61-4 | Molecular Weight | 250.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15ClN2O |
|---|---|
| Molecular Weight | 250.72 |
| InChIKey | TYOBJRWPEZMMEC-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2cccc(N(C)C)c2)oc1CCl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline? |
| A: Molecular weight of 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline is 250.72. |
| Q: What is the SMILES notation of 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline? |
| A: SMILES notation of 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline is Cc1nc(-c2cccc(N(C)C)c2)oc1CCl. |
| Q: What is the English name of 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline? |
| A: The English name of 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline is 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline. |
| Q: What is the molecular formula of 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline? |
| A: Molecular formula of 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline is C13H15ClN2O. |
| Q: What is the CAS number of 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline? |
| A: CAS number of 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline is 2007738-61-4. |
| Q: What is the Chinese name of 2007738-61-4? |
| A: Chinese name of 2007738-61-4 is 2007738-61-4. |
| Q: What is the InChIKey of 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline? |
| A: InChIKey of 3-[5-(Chloromethyl)-4-methyl-1,3-oxazol-2-yl]-N,N-dimethylaniline is TYOBJRWPEZMMEC-UHFFFAOYSA-N. |