(S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid
Modify Date: 2025-09-09 18:49:36
(S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid structure
|
Common Name | (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2007910-60-1 | Molecular Weight | 269.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17F2NO2 |
|---|---|
| Molecular Weight | 269.29 |
| InChIKey | LIIDOJBWCNYUOH-PWSUYJOCSA-N |
| SMILES | CC(c1ccccc1)N1CCC(F)(F)CC1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid? |
| A: The English name of (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid is (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid. |
| Q: What is the SMILES notation of (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid? |
| A: SMILES notation of (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid is CC(c1ccccc1)N1CCC(F)(F)CC1C(=O)O. |
| Q: What is the molecular formula of (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid? |
| A: Molecular formula of (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid is C14H17F2NO2. |
| Q: What is the molecular weight of (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid? |
| A: Molecular weight of (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid is 269.29. |
| Q: What is the InChIKey of (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid? |
| A: InChIKey of (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid is LIIDOJBWCNYUOH-PWSUYJOCSA-N. |
| Q: What is the CAS number of (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid? |
| A: CAS number of (S)-4,4-difluoro-1-((R)-1-phenylethyl)piperidine-2-carboxylic acid is 2007910-60-1. |
| Q: What is the Chinese name of 2007910-60-1? |
| A: Chinese name of 2007910-60-1 is 2007910-60-1. |