6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one
Modify Date: 2025-09-10 05:31:56
6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one structure
|
Common Name | 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one | ||
|---|---|---|---|---|
| CAS Number | 2007915-92-4 | Molecular Weight | 249.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7Cl3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7Cl3O |
|---|---|
| Molecular Weight | 249.5 |
| InChIKey | SISGITNYWMPRQH-UHFFFAOYSA-N |
| SMILES | O=C1CCc2ccc(C(Cl)(Cl)Cl)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one? |
| A: InChIKey of 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one is SISGITNYWMPRQH-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one? |
| A: SMILES notation of 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one is O=C1CCc2ccc(C(Cl)(Cl)Cl)cc21. |
| Q: What is the Chinese name of 2007915-92-4? |
| A: Chinese name of 2007915-92-4 is 2007915-92-4. |
| Q: What is the English name of 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one? |
| A: The English name of 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one is 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one. |
| Q: What is the molecular weight of 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one? |
| A: Molecular weight of 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one is 249.5. |
| Q: What is the molecular formula of 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one? |
| A: Molecular formula of 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one is C10H7Cl3O. |
| Q: What is the CAS number of 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one? |
| A: CAS number of 6-(Trichloromethyl)-2,3-dihydro-1H-inden-1-one is 2007915-92-4. |