5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate
Modify Date: 2026-08-08 09:15:06
![5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate Structure](https://www.chemsrc.com/extcaspic/385/2007916-76-7.png)
5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate structure
|
Common Name | 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2007916-76-7 | Molecular Weight | 299.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10ClNO4S |
|---|---|
| Molecular Weight | 299.73 |
| InChIKey | CSSPHWNTUMSYFO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(Cl)c2scc(C(=O)OC)c2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate? |
| A: InChIKey of 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate is CSSPHWNTUMSYFO-UHFFFAOYSA-N. |
| Q: What is the English name of 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate? |
| A: The English name of 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate is 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate. |
| Q: What is the Chinese name of 2007916-76-7? |
| A: Chinese name of 2007916-76-7 is 2007916-76-7. |
| Q: What is the molecular formula of 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate? |
| A: Molecular formula of 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate is C12H10ClNO4S. |
| Q: What is the SMILES notation of 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate? |
| A: SMILES notation of 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate is CCOC(=O)c1cc(Cl)c2scc(C(=O)OC)c2n1. |
| Q: What is the molecular weight of 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate? |
| A: Molecular weight of 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate is 299.73. |
| Q: What is the CAS number of 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate? |
| A: CAS number of 5-Ethyl 3-methyl 7-chlorothieno[3,2-b]pyridine-3,5-dicarboxylate is 2007916-76-7. |