3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide
Modify Date: 2026-07-08 17:27:41
3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide structure
|
Common Name | 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 2007920-53-6 | Molecular Weight | 324.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H24N2O5 |
|---|---|
| Molecular Weight | 324.37 |
| InChIKey | FAVPAEROZAGNME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc[n+]([O-])c1)C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2007920-53-6? |
| A: Chinese name of 2007920-53-6 is 2007920-53-6. |
| Q: What is the molecular weight of 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide? |
| A: Molecular weight of 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide is 324.37. |
| Q: What is the InChIKey of 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide? |
| A: InChIKey of 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide is FAVPAEROZAGNME-UHFFFAOYSA-N. |
| Q: What is the English name of 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide? |
| A: The English name of 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide is 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide. |
| Q: What is the SMILES notation of 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide? |
| A: SMILES notation of 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide is CC(C)(C)OC(=O)N(Cc1ccc[n+]([O-])c1)C(=O)OC(C)(C)C. |
| Q: What is the molecular formula of 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide? |
| A: Molecular formula of 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide is C16H24N2O5. |
| Q: What is the CAS number of 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide? |
| A: CAS number of 3-(((BI-Tert-butoxycarbonyl)amino)methyl)pyridine 1-oxide is 2007920-53-6. |