(E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate
Modify Date: 2026-07-20 14:04:37
![(E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate Structure](https://www.chemsrc.com/extcaspic/144/2007931-01-1.png)
(E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate structure
|
Common Name | (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate | ||
|---|---|---|---|---|
| CAS Number | 2007931-01-1 | Molecular Weight | 386.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H26N2O2 |
|---|---|
| Molecular Weight | 386.5 |
| InChIKey | BIKUFJLYWZKUMI-CXUHLZMHSA-N |
| SMILES | COC(=O)C=Cc1cccc(NCc2ccc(-c3ccc(N(C)C)cc3)cc2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2007931-01-1? |
| A: Chinese name of 2007931-01-1 is 2007931-01-1. |
| Q: What is the InChIKey of (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate? |
| A: InChIKey of (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate is BIKUFJLYWZKUMI-CXUHLZMHSA-N. |
| Q: What is the SMILES notation of (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate? |
| A: SMILES notation of (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate is COC(=O)C=Cc1cccc(NCc2ccc(-c3ccc(N(C)C)cc3)cc2)c1. |
| Q: What is the English name of (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate? |
| A: The English name of (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate is (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate. |
| Q: What is the molecular formula of (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate? |
| A: Molecular formula of (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate is C25H26N2O2. |
| Q: What is the molecular weight of (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate? |
| A: Molecular weight of (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate is 386.5. |
| Q: What is the CAS number of (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate? |
| A: CAS number of (E)-methyl 3-(3-(((4'-(dimethylamino)-[1,1'-biphenyl]-4-yl)methyl)amino)phenyl)acrylate is 2007931-01-1. |