6-Nitro-2-tetralone structure
|
Common Name | 6-Nitro-2-tetralone | ||
|---|---|---|---|---|
| CAS Number | 200864-16-0 | Molecular Weight | 191.18300 | |
| Density | 1.322g/cm3 | Boiling Point | 357ºC at 760 mmHg | |
| Molecular Formula | C10H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-nitro-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 357ºC at 760 mmHg |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.18300 |
| Exact Mass | 191.05800 |
| PSA | 62.89000 |
| LogP | 2.17580 |
| Vapour Pressure | 2.82E-05mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | CNXOOCPWNIMFFF-UHFFFAOYSA-N |
| SMILES | O=C1CCc2cc([N+](=O)[O-])ccc2C1 |
|
~27%
6-Nitro-2-tetralone CAS#:200864-16-0 |
| Literature: Journal of the American Chemical Society, , vol. 119, # 52 p. 12722 - 12726 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-nitro-2-tetralone |