3-(5-nitropyridin-2-yloxy)-2-methylpyridine structure
|
Common Name | 3-(5-nitropyridin-2-yloxy)-2-methylpyridine | ||
|---|---|---|---|---|
| CAS Number | 200940-26-7 | Molecular Weight | 231.20700 | |
| Density | 1.324g/cm3 | Boiling Point | 353.979ºC at 760 mmHg | |
| Molecular Formula | C11H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.881ºC | |
| Name | 2-methyl-3-(5-nitropyridin-2-yl)oxypyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 353.979ºC at 760 mmHg |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.20700 |
| Flash Point | 167.881ºC |
| Exact Mass | 231.06400 |
| PSA | 80.83000 |
| LogP | 3.00870 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | HHJZXWHOKJJPCT-UHFFFAOYSA-N |
| SMILES | Cc1ncccc1Oc1ccc([N+](=O)[O-])cn1 |
| HS Code | 2933399090 |
|---|
|
~98%
3-(5-nitropyrid... CAS#:200940-26-7 |
| Literature: KOREA RESERACH INSTITUTE OF CHEMICAL TECHNOLOGY Patent: WO2009/125923 A2, 2009 ; Location in patent: Page/Page column 21-22 ; WO 2009/125923 A2 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| i02-2818 |