3,3-diethyl-5-(hydroxymethyl)pyridine-2,4(1H,3H-dione structure
|
Common Name | 3,3-diethyl-5-(hydroxymethyl)pyridine-2,4(1H,3H-dione | ||
|---|---|---|---|---|
| CAS Number | 20096-03-1 | Molecular Weight | 197.23100 | |
| Density | 1.102g/cm3 | Boiling Point | 413.7ºC at 760 mmHg | |
| Molecular Formula | C10H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204ºC | |
| Name | 3,3-diethyl-5-(hydroxymethyl)-1H-pyridine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 413.7ºC at 760 mmHg |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23100 |
| Flash Point | 204ºC |
| Exact Mass | 197.10500 |
| PSA | 69.89000 |
| LogP | 0.64380 |
| Vapour Pressure | 1.42E-08mmHg at 25°C |
| Index of Refraction | 1.482 |
| InChIKey | LRBLMOZKEZGJGQ-UHFFFAOYSA-N |
| SMILES | CCC1(CC)C(=O)NC=C(CO)C1=O |
| HS Code | 2933399090 |
|---|
|
~%
3,3-diethyl-5-(... CAS#:20096-03-1 |
| Literature: Hoffmann-La Roche Patent: DE930206 , 1953 ; Full Text Show Details Hoffmann-La Roche Patent: US2845431 , 1956 ; |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 243-509-5 |
| 3,3-diethyl-5-hydroxymethyl-1H-pyridine-2,4-dione |
| 3,3-Diaethyl-5-hydroxymethyl-1H-pyridin-2,4-dion |
| 3,3-Diethyl-5-hydroxymethyl-2,4-pyridinedione |