1,2-bis(2,3,5,6-tetrafluorophenyl)hydrazine structure
|
Common Name | 1,2-bis(2,3,5,6-tetrafluorophenyl)hydrazine | ||
|---|---|---|---|---|
| CAS Number | 2010-73-3 | Molecular Weight | 328.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H4F8N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-bis(2,3,5,6-tetrafluorophenyl)hydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H4F8N2 |
|---|---|
| Molecular Weight | 328.16100 |
| Exact Mass | 328.02500 |
| PSA | 24.06000 |
| LogP | 4.38440 |
| InChIKey | CGFODVIRAZACDC-UHFFFAOYSA-N |
| SMILES | Fc1cc(F)c(F)c(NNc2c(F)c(F)cc(F)c2F)c1F |
|
~%
1,2-bis(2,3,5,6... CAS#:2010-73-3 |
| Literature: Gmelin Handbook: F: PerFHalOrg.8, 3, page 55 - 151 |
|
~%
1,2-bis(2,3,5,6... CAS#:2010-73-3 |
| Literature: Burdon,J. et al. Journal of the Chemical Society, 1965 , p. 2621 - 2627 |
|
~%
1,2-bis(2,3,5,6... CAS#:2010-73-3 |
| Literature: Burdon,J. et al. Journal of the Chemical Society, 1965 , p. 2621 - 2627 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4,4'-HC6F4NHNHC6F4H |
| 4H,4H'-Octafluor-hydrazobenzol |