(2E,4E)-3-Methyl-5-(2,6,6-triMethyl-1,3-cyclohexadien-1-yl)-2,4-pentadienenitrile
(2E,4E)-3-Methyl-5-(2,6,6-triMethyl-1,3-cyclohexadien-1-yl)-2,4-pentadienenitrile structure
|
Common Name | (2E,4E)-3-Methyl-5-(2,6,6-triMethyl-1,3-cyclohexadien-1-yl)-2,4-pentadienenitrile | ||
|---|---|---|---|---|
| CAS Number | 20109-91-5 | Molecular Weight | 213.31800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19N |
|---|---|
| Molecular Weight | 213.31800 |
| Exact Mass | 213.15200 |
| PSA | 23.79000 |
| LogP | 4.31508 |
| InChIKey | KGVHLYFWYDAEHU-ANKZSMJWSA-N |
| SMILES | CC(C=CC1=C(C)C=CCC1(C)C)=CC#N |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:25528-87-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2E,4E)-3-Methyl-5-(2,6,6-trimethyl-1,3-cyclohexadien-1-yl)-2,4-pentadienenitrile |
| Dehydro- |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile? |
| A: Molecular weight of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile is 213.31800. |
| Q: What is the polar surface area (PSA) of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile? |
| A: Polar surface area (PSA) of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile is 23.79000. |
| Q: What is the English name of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile? |
| A: The English name of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile is (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile. |
| Q: What is the SMILES notation of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile? |
| A: SMILES notation of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile is CC(C=CC1=C(C)C=CCC1(C)C)=CC#N. |
| Q: What is the InChIKey of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile? |
| A: InChIKey of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile is KGVHLYFWYDAEHU-ANKZSMJWSA-N. |
| Q: What is the molecular formula of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile? |
| A: Molecular formula of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile is C15H19N. |
| Q: What is the LogP of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile? |
| A: LogP of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile is 4.31508. |
| Q: What is the CAS number of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile? |
| A: CAS number of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile is 20109-91-5. |
| Q: What English synonyms does (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile have? |
| A: English synonyms of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile: (2E,4E)-3-Methyl-5-(2,6,6-trimethyl-1,3-cyclohexadien-1-yl)-2,4-pentadienenitrile, Dehydro-. |
| Q: What are the downstream products of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile? |
| A: Related downstream products(CAS) of (2E,4E)-3-methyl-5-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2,4-pentanedienenitrile: 25528-87-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |