Macusine A chloride
Modify Date: 2025-09-25 17:17:59
Macusine A chloride structure
|
Common Name | Macusine A chloride | ||
|---|---|---|---|---|
| CAS Number | 2011-21-4 | Molecular Weight | 402.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H27ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Macusine A chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H27ClN2O3 |
|---|---|
| Molecular Weight | 402.9 |
| InChIKey | XZCJRBLVMDQZHO-PVFPYHDPSA-M |
| SMILES | CC=C1C[N+]2(C)C3CC1C(CO)(C(=O)OC)C2Cc1c3[nH]c2ccccc12.[Cl-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Macusine A chloride? |
| A: InChIKey of Macusine A chloride is XZCJRBLVMDQZHO-PVFPYHDPSA-M. |
| Q: What is the molecular weight of Macusine A chloride? |
| A: Molecular weight of Macusine A chloride is 402.9. |
| Q: What is the Chinese name of 2011-21-4? |
| A: Chinese name of 2011-21-4 is 2011-21-4. |
| Q: What is the CAS number of Macusine A chloride? |
| A: CAS number of Macusine A chloride is 2011-21-4. |
| Q: What is the SMILES notation of Macusine A chloride? |
| A: SMILES notation of Macusine A chloride is CC=C1C[N+]2(C)C3CC1C(CO)(C(=O)OC)C2Cc1c3[nH]c2ccccc12.[Cl-]. |
| Q: What is the English name of Macusine A chloride? |
| A: The English name of Macusine A chloride is Macusine A chloride. |
| Q: What is the molecular formula of Macusine A chloride? |
| A: Molecular formula of Macusine A chloride is C22H27ClN2O3. |