2,6-bis((dimethylamino)methyl)cyclohexanone structure
|
Common Name | 2,6-bis((dimethylamino)methyl)cyclohexanone | ||
|---|---|---|---|---|
| CAS Number | 20115-17-7 | Molecular Weight | 248.79300 | |
| Density | 0.941g/cm3 | Boiling Point | 285.6ºC at 760 mmHg | |
| Molecular Formula | C12H25ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.1ºC | |
| Name | 2,6-bis[(dimethylamino)methyl]cyclohexan-1-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 0.941g/cm3 |
|---|---|
| Boiling Point | 285.6ºC at 760 mmHg |
| Molecular Formula | C12H25ClN2O |
| Molecular Weight | 248.79300 |
| Flash Point | 101.1ºC |
| Exact Mass | 248.16600 |
| PSA | 23.55000 |
| LogP | 1.89700 |
| Vapour Pressure | 0.00278mmHg at 25°C |
| Index of Refraction | 1.471 |
| InChIKey | JKDMLBMSEBGSQF-UHFFFAOYSA-N |
| SMILES | CN(C)CC1CCCC(CN(C)C)C1=O.Cl |
|
~%
2,6-bis((dimeth... CAS#:20115-17-7 |
| Literature: JX NIPPON OIL and ENERGY CORPORATION Patent: US2012/310013 A1, 2012 ; Location in patent: Page/Page column 12 ; |
|
~66%
2,6-bis((dimeth... CAS#:20115-17-7 |
| Literature: Dimmock, JR; Sidhu, KK; Chen, M; Reid, RS; Allen, TM; et al. European Journal of Medicinal Chemistry, 1993 , vol. 28, # 4 p. 313 - 322 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 2,6-Bis-dimethylaminomethyl-cyclohexanon,Dihydrochlorid |
| 2,6-Bis-dibenzylaminomethyl-cyclohexanon,Dihydrochlorid |
| 2,6-bis-dimethylaminomethyl-cyclohexanone,dihydrochloride |
| 2,6-bis-chloromethyl-pyrazine |
| 2,6-bis-dibenzylaminomethyl-cyclohexanone,dihydrochloride |