tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate
tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate structure
|
Common Name | tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 201218-07-7 | Molecular Weight | 323.69500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13ClF3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13ClF3NO3 |
|---|---|
| Molecular Weight | 323.69500 |
| Exact Mass | 323.05400 |
| PSA | 55.40000 |
| LogP | 4.50500 |
| InChIKey | WYMLOCHHKMMBLA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cl)cc1C(=O)C(F)(F)F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:177530-93-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-tert-Butoxycarbonyl-4-chloro-2-trifluoroacetylaniline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate? |
| A: LogP of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate is 4.50500. |
| Q: What are the downstream products of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate? |
| A: Related downstream products(CAS) of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate: 177530-93-7. |
| Q: What English synonyms does tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate have? |
| A: English synonyms of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate: N-tert-Butoxycarbonyl-4-chloro-2-trifluoroacetylaniline. |
| Q: What is the CAS number of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate? |
| A: CAS number of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate is 201218-07-7. |
| Q: What is the Chinese name of 201218-07-7? |
| A: Chinese name of 201218-07-7 is 201218-07-7. |
| Q: What is the molecular weight of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate? |
| A: Molecular weight of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate is 323.69500. |
| Q: What is the InChIKey of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate? |
| A: InChIKey of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate is WYMLOCHHKMMBLA-UHFFFAOYSA-N. |
| Q: What is the English name of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate? |
| A: The English name of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate is tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate. |
| Q: What is the polar surface area (PSA) of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate? |
| A: Polar surface area (PSA) of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate is 55.40000. |
| Q: What is the SMILES notation of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate? |
| A: SMILES notation of tert-butyl (4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)carbamate is CC(C)(C)OC(=O)Nc1ccc(Cl)cc1C(=O)C(F)(F)F. |