Diosmetin-7-O-beta-D-glucopyranoside structure
|
Common Name | Diosmetin-7-O-beta-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 20126-59-4 | Molecular Weight | 462.404 | |
| Density | 1.609 | Boiling Point | 803.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C22H22O11 | Melting Point | 253-255 ºC | |
| MSDS | N/A | Flash Point | 281.7±27.8 °C | |
Use of Diosmetin-7-O-beta-D-glucopyranosideDiosmetin-7-O-β-D-glucopyranoside is a natural product isolated from the flowers of Chrysanthemum morifolium, with antioxidant activity[1][2]. |
| Name | diosmetin 7-O-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Diosmetin-7-O-β-D-glucopyranoside is a natural product isolated from the flowers of Chrysanthemum morifolium, with antioxidant activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.609 |
|---|---|
| Boiling Point | 803.6±65.0 °C at 760 mmHg |
| Melting Point | 253-255 ºC |
| Molecular Formula | C22H22O11 |
| Molecular Weight | 462.404 |
| Flash Point | 281.7±27.8 °C |
| Exact Mass | 462.116211 |
| PSA | 179.28000 |
| LogP | 0.61 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | WKUHPOMCLBLCOV-MIUGBVLSSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(OC4OC(CO)C(O)C(O)C4O)cc3o2)cc1O |
| Storage condition | -20C |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| DIOSMETIN-7-O-B-D-GLUCOPYRANOSIDE |
| 4H-1-Benzopyran-4-one, 7-(β-D-glucopyranosyloxy)-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)- |
| Diosmetin-7-glucoside |
| Diosmetin-7-O-Beta-D-glucopYHanoside |
| 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl β-D-glucopyranoside |
| Diosmetin-7-O-Beta-D-glucopyranoside |
| Diosmetin 7-O-beta-D-glucoside |