1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone
Modify Date: 2026-06-25 19:05:04
1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone structure
|
Common Name | 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone | ||
|---|---|---|---|---|
| CAS Number | 201284-76-6 | Molecular Weight | 272.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H16O4 |
|---|---|
| Molecular Weight | 272.29 |
| InChIKey | RHBSLIMVGWKFQW-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)OCC(=O)C2=C(C=C(C=C2)O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of human KLF10 expressed in human HeLa cells assessed as reduction in KLF1...
Source: ChEMBL
Target: Krueppel-like factor 10
External Id: CHEMBL4419303
|
|
Name: Inhibition of human KLF10 expressed in human HeLa cells assessed as reduction in KLF1...
Source: ChEMBL
Target: Krueppel-like factor 10
External Id: CHEMBL4419304
|
|
Name: Inhibition of human KLF10 expressed in human HeLa cells assessed as reduction in tran...
Source: ChEMBL
Target: Krueppel-like factor 10
External Id: CHEMBL3411252
|
|
Name: Inhibition of human KLF10 expressed in human HeLa cells assessed as reduction in tran...
Source: ChEMBL
Target: Krueppel-like factor 10
External Id: CHEMBL3411253
|
Total 4, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone? |
| A: Molecular weight of 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone is 272.29. |
| Q: What is the English name of 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone? |
| A: The English name of 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone is 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone. |
| Q: What is the SMILES notation of 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone? |
| A: SMILES notation of 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone is CCC1=CC=C(C=C1)OCC(=O)C2=C(C=C(C=C2)O)O. |
| Q: What is the molecular formula of 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone? |
| A: Molecular formula of 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone is C16H16O4. |
| Q: What is the CAS number of 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone? |
| A: CAS number of 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone is 201284-76-6. |
| Q: What is the InChIKey of 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone? |
| A: InChIKey of 1-(2,4-Dihydroxyphenyl)-2-(4-Ethylphenoxy)Ethanone is RHBSLIMVGWKFQW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 201284-76-6? |
| A: Chinese name of 201284-76-6 is 201284-76-6. |