3-Methyl-1H-indole-6-carboxylic acid structure
|
Common Name | 3-Methyl-1H-indole-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 201286-69-3 | Molecular Weight | 175.18400 | |
| Density | 1.340±0.06 g/cm3(Predicted) | Boiling Point | 416.9±25.0 °C(Predicted) | |
| Molecular Formula | C10H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Methyl-1H-indole-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.340±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 416.9±25.0 °C(Predicted) |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.18400 |
| Exact Mass | 175.06300 |
| PSA | 53.09000 |
| LogP | 2.17450 |
| InChIKey | NYOPDHGKWNANDV-UHFFFAOYSA-N |
| SMILES | Cc1c[nH]c2cc(C(=O)O)ccc12 |
| HS Code | 2933990090 |
|---|
|
~87%
3-Methyl-1H-ind... CAS#:201286-69-3 |
| Literature: Hulme, Christopher; Moriarty, Kevin; Miller, Bruce; Mathew, Rose; Ramanjulu, Mercy; Cox, Paul; Souness, John; Page, Ken M.; Uhl, Joanne; Travis, Jeffrey; Huang, Fu-Chih; Labaudiniere, Richard; Djuric, Stevan W. Bioorganic and Medicinal Chemistry Letters, 1998 , vol. 8, # 14 p. 1867 - 1872 |
|
~%
3-Methyl-1H-ind... CAS#:201286-69-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 8, # 14 p. 1867 - 1872 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-6-carboxylicacid,3-methyl |
| 3-methyl-1 H-indole-6-carboxylic acid |
| 3-methyl-indole-6-carboxylic acid |