3-Methyl-1H-indazole-6-carboxylic acid structure
|
Common Name | 3-Methyl-1H-indazole-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 201286-96-6 | Molecular Weight | 176.172 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 439.1±25.0 °C at 760 mmHg | |
| Molecular Formula | C9H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.4±23.2 °C | |
| Name | 3-methyl-2H-indazole-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 439.1±25.0 °C at 760 mmHg |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.172 |
| Flash Point | 219.4±23.2 °C |
| Exact Mass | 176.058578 |
| PSA | 65.98000 |
| LogP | 1.96 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.709 |
| InChIKey | HJVKVWJWZDGWCG-UHFFFAOYSA-N |
| SMILES | Cc1[nH]nc2cc(C(=O)O)ccc12 |
| HS Code | 2933990090 |
|---|
|
~17%
3-Methyl-1H-ind... CAS#:201286-96-6 |
| Literature: Fujisawa Pharmaceutical Co., Ltd. Patent: US6348474 B1, 2002 ; Location in patent: Page column 80,81 ; |
|
~82%
3-Methyl-1H-ind... CAS#:201286-96-6 |
| Literature: PFIZER PRODUCTS INC. Patent: WO2008/65508 A1, 2008 ; Location in patent: Page/Page column 30-31 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Methyl-1H-indazole-6-carboxylic acid |
| 3-methyl-indazole-6-carboxylic acid |
| 6-Carboxy-3-methyl-1H-indazole |
| Y5334 |
| 1H-Indazole-6-carboxylic acid, 3-methyl- |