2,5-Cyclohexadiene-1,4-dione,2,5-dihydroxy-3,6-bis(1-oxopropoxy)- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-dihydroxy-3,6-bis(1-oxopropoxy)- | ||
|---|---|---|---|---|
| CAS Number | 20129-60-6 | Molecular Weight | 284.21900 | |
| Density | 1.49g/cm3 | Boiling Point | 420.7ºC at 760mmHg | |
| Molecular Formula | C12H12O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.7ºC | |
| Name | (2,5-dihydroxy-3,6-dioxo-4-propanoyloxycyclohexa-1,4-dien-1-yl) propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 420.7ºC at 760mmHg |
| Molecular Formula | C12H12O8 |
| Molecular Weight | 284.21900 |
| Flash Point | 158.7ºC |
| Exact Mass | 284.05300 |
| PSA | 127.20000 |
| LogP | 0.58380 |
| Vapour Pressure | 7.74E-09mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | SOAWVLIPJVKEKT-UHFFFAOYSA-N |
| SMILES | CCC(=O)OC1=C(O)C(=O)C(OC(=O)CC)=C(O)C1=O |
|
~%
2,5-Cyclohexadi... CAS#:20129-60-6 |
| Literature: Hoglan; Bartow Journal of the American Chemical Society, 1940 , vol. 62, p. 2397,2398 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,5-dihydroxy-3,6-dioxocyclohexa-1,4-diene-1,4-diyl dipropanoate |
| 2,5-dihydroxy-3,6-bis-propionyloxy-[1,4]benzoquinone |
| 2,5-Dihydroxy-3,6-bis-propionyloxy-[1,4]benzochinon |
| 2,5-Dihydroxy-3,6-dipropionyloxy-1,4-chinon |
| 2,5-Cyclohexadiene-1,4-dione,2,5-dihydroxy-3,6-bis(1-oxopropoxy) |