(2,3,4,5,6-pentabutanoyloxyphenyl) butanoate structure
|
Common Name | (2,3,4,5,6-pentabutanoyloxyphenyl) butanoate | ||
|---|---|---|---|---|
| CAS Number | 20129-67-3 | Molecular Weight | 594.64700 | |
| Density | 1.158g/cm3 | Boiling Point | 651.5ºC at 760 mmHg | |
| Molecular Formula | C30H42O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.6ºC | |
| Name | [2,3,4,5,6-penta(butanoyloxy)phenyl] butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 651.5ºC at 760 mmHg |
| Molecular Formula | C30H42O12 |
| Molecular Weight | 594.64700 |
| Flash Point | 268.6ºC |
| Exact Mass | 594.26800 |
| PSA | 157.80000 |
| LogP | 5.91960 |
| Vapour Pressure | 7.4E-17mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | MZEZQOKVBJQTDN-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Oc1c(OC(=O)CCC)c(OC(=O)CCC)c(OC(=O)CCC)c(OC(=O)CCC)c1OC(=O)CCC |
|
~%
(2,3,4,5,6-pent... CAS#:20129-67-3 |
| Literature: Neifert; Bartow Journal of the American Chemical Society, 1943 , vol. 65, p. 1770 |
|
~%
(2,3,4,5,6-pent... CAS#:20129-67-3 |
| Literature: Backer; van der Baan Recueil des Travaux Chimiques des Pays-Bas, 1937 , vol. 56, p. 1161,1165 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Hexabutyryloxy-benzol |
| Hexakis-butyryloxy-benzol |
| hexakis-butyryloxy-benzene |