1,3-Propanediol,2-methyl-2-nitro-, cyclic P,P:P',P'-pyrophosphate (8CI) structure
|
Common Name | 1,3-Propanediol,2-methyl-2-nitro-, cyclic P,P:P',P'-pyrophosphate (8CI) | ||
|---|---|---|---|---|
| CAS Number | 20133-56-6 | Molecular Weight | 376.15100 | |
| Density | 1.62g/cm3 | Boiling Point | 414.6ºC at 760mmHg | |
| Molecular Formula | C8H14N2O11P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.5ºC | |
| Name | 5-methyl-2-[(5-methyl-5-nitro-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]-5-nitro-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 414.6ºC at 760mmHg |
| Molecular Formula | C8H14N2O11P2 |
| Molecular Weight | 376.15100 |
| Flash Point | 204.5ºC |
| Exact Mass | 376.00700 |
| PSA | 191.55000 |
| LogP | 2.43000 |
| Vapour Pressure | 4.4E-07mmHg at 25°C |
| Index of Refraction | 1.51 |
| InChIKey | SGEAYRJOFDICCL-UHFFFAOYSA-N |
| SMILES | CC1([N+](=O)[O-])COP(=O)(OP2(=O)OCC(C)([N+](=O)[O-])CO2)OC1 |
|
~%
1,3-Propanediol... CAS#:20133-56-6 |
| Literature: Billman; May; Heard Journal of pharmaceutical sciences, 1968 , vol. 57, # 9 p. 1622 - 1625 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |