5-ethyl-2-[(5-ethyl-5-nitro-2-oxo-1,3-dioxa-2$l^C10H18N2O11P2-phosphacyclohex-2-yl)oxy]-5-nitro-1,3-dioxa-2$l^C10H18N2 structure
|
Common Name | 5-ethyl-2-[(5-ethyl-5-nitro-2-oxo-1,3-dioxa-2$l^C10H18N2O11P2-phosphacyclohex-2-yl)oxy]-5-nitro-1,3-dioxa-2$l^C10H18N2 | ||
|---|---|---|---|---|
| CAS Number | 20133-65-7 | Molecular Weight | 404.20400 | |
| Density | 1.53g/cm3 | Boiling Point | 439.9ºC at 760 mmHg | |
| Molecular Formula | C10H18N2O11P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.8ºC | |
| Name | 2,2'-oxybis(5-ethyl-5-nitro-1,3,2-dioxaphosphinane 2-oxide) |
|---|
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 439.9ºC at 760 mmHg |
| Molecular Formula | C10H18N2O11P2 |
| Molecular Weight | 404.20400 |
| Flash Point | 219.8ºC |
| Exact Mass | 404.03900 |
| PSA | 191.55000 |
| LogP | 3.21020 |
| Vapour Pressure | 6.15E-08mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | VQLCTQLLBUFIRV-UHFFFAOYSA-N |
| SMILES | CCC1([N+](=O)[O-])COP(=O)(OP2(=O)OCC(CC)([N+](=O)[O-])CO2)OC1 |
|
~%
5-ethyl-2-[(5-e... CAS#:20133-65-7 |
| Literature: Billman; May; Heard Journal of pharmaceutical sciences, 1968 , vol. 57, # 9 p. 1622 - 1625 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |