5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol
Modify Date: 2026-09-24 17:59:17
![5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol Structure](https://www.chemsrc.com/extcaspic/186/2014373-37-4.png)
5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol structure
|
Common Name | 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol | ||
|---|---|---|---|---|
| CAS Number | 2014373-37-4 | Molecular Weight | 239.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14ClNO2 |
|---|---|
| Molecular Weight | 239.70 |
| InChIKey | DOYIJEIKEPHHMY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Cl)nc2cc(CO)oc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2014373-37-4? |
| A: Chinese name of 2014373-37-4 is 2014373-37-4. |
| Q: What is the InChIKey of 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol? |
| A: InChIKey of 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol is DOYIJEIKEPHHMY-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol? |
| A: CAS number of 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol is 2014373-37-4. |
| Q: What is the molecular formula of 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol? |
| A: Molecular formula of 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol is C12H14ClNO2. |
| Q: What is the English name of 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol? |
| A: The English name of 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol is 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol. |
| Q: What is the molecular weight of 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol? |
| A: Molecular weight of 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol is 239.70. |
| Q: What is the SMILES notation of 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol? |
| A: SMILES notation of 5-Chloro-7-(1,1-dimethylethyl)-furo[3,2-b]pyridine-2-methanol is CC(C)(C)c1cc(Cl)nc2cc(CO)oc12. |