1H-Indole-2,3-dione,3-[2-(2-pyridinyl)hydrazone] structure
|
Common Name | 1H-Indole-2,3-dione,3-[2-(2-pyridinyl)hydrazone] | ||
|---|---|---|---|---|
| CAS Number | 20144-03-0 | Molecular Weight | 238.24500 | |
| Density | 1.38g/cm3 | Boiling Point | 386.9ºC at 760mmHg | |
| Molecular Formula | C13H10N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.8ºC | |
| Name | 3-(2-pyridin-2-ylhydrazinyl)indol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 386.9ºC at 760mmHg |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.24500 |
| Flash Point | 187.8ºC |
| Exact Mass | 238.08500 |
| PSA | 69.61000 |
| LogP | 1.40980 |
| Vapour Pressure | 3.43E-06mmHg at 25°C |
| Index of Refraction | 1.716 |
| InChIKey | RAKUQDIILFQMQB-UHFFFAOYSA-N |
| SMILES | Oc1[nH]c2ccccc2c1N=Nc1ccccn1 |
| HS Code | 2933790090 |
|---|
|
~%
1H-Indole-2,3-d... CAS#:20144-03-0 |
| Literature: Popp Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 6 p. 1641 - 1645 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
| 3-<Pyridyl-(2)-hydrazono>-oxindol |