5-Amino-2-chlorobenzenesulfonamide structure
|
Common Name | 5-Amino-2-chlorobenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 2015-19-2 | Molecular Weight | 206.65000 | |
| Density | 1.558 | Boiling Point | 454.5ºC at 760mmHg | |
| Molecular Formula | C6H7ClN2O2S | Melting Point | 169-171ºC | |
| MSDS | N/A | Flash Point | 228.7ºC | |
| Name | 5-Amino-2-chlorobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.558 |
|---|---|
| Boiling Point | 454.5ºC at 760mmHg |
| Melting Point | 169-171ºC |
| Molecular Formula | C6H7ClN2O2S |
| Molecular Weight | 206.65000 |
| Flash Point | 228.7ºC |
| Exact Mass | 205.99200 |
| PSA | 94.56000 |
| LogP | 2.93190 |
| Vapour Pressure | 1.89E-08mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | FDDSVQLOFIBCDH-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cl)c(S(N)(=O)=O)c1 |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: Inhibition of human recombinant CA2 by stopped flow CO2 hydration assay
Source: ChEMBL
Target: Carbonic anhydrase 2
External Id: CHEMBL956494
|
|
Name: Inhibition of human cloned CA9 catalytic domain by stopped flow CO2 hydration assay
Source: ChEMBL
Target: Carbonic anhydrase 9
External Id: CHEMBL956495
|
|
Name: Inhibition of human recombinant CA1 by stopped flow CO2 hydration assay
Source: ChEMBL
Target: Carbonic anhydrase 1
External Id: CHEMBL956493
|
|
Name: Selectivity for human cloned CA12 over human recombinant CA2
Source: ChEMBL
Target: N/A
External Id: CHEMBL956500
|
|
Name: Selectivity for human cloned CA9 over human recombinant CA2
Source: ChEMBL
Target: N/A
External Id: CHEMBL956498
|
|
Name: Selectivity for human cloned CA12 over human recombinant CA1
Source: ChEMBL
Target: N/A
External Id: CHEMBL956499
|
|
Name: Inhibition of human cloned CA12 catalytic domain by stopped flow CO2 hydration assay
Source: ChEMBL
Target: Carbonic anhydrase 12
External Id: CHEMBL956496
|
|
Name: Selectivity for human cloned CA9 over human recombinant CA1
Source: ChEMBL
Target: N/A
External Id: CHEMBL956497
|
| 5-Amino-2-chlor-benzolsulfonamid |
| 3-aminosulfonyl-4-chloroaniline |
| 4-Chloroaniline-3-sulfonamide |
| 4-Chloranilin-5-sulfonamid |
| EINECS 217-943-0 |
| 4-Chlor-3-sulfamoylanilin |
| 4-chloro-3-sulfamoylaniline |